
CAS 893738-07-3
:2-Furancarboxylic acid, 5-[4-(methylsulfonyl)phenyl]-
Description:
2-Furancarboxylic acid, 5-[4-(methylsulfonyl)phenyl]- is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the furan ring, contributing to its acidity and reactivity. Additionally, it has a para-substituted phenyl group at the 5-position, which is further substituted with a methylsulfonyl group (-SO2CH3), enhancing its solubility and polar characteristics. The presence of the methylsulfonyl group can also influence the compound's biological activity and interactions with other molecules. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, depending on its specific reactivity and interactions. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties, such as melting point and solubility in various solvents.
Formula:C12H10O5S
InChI:InChI=1S/C12H10O5S/c1-18(15,16)9-4-2-8(3-5-9)10-6-7-11(17-10)12(13)14/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=KOXGKEZYGKWJMZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=CC1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:- 5-[4-(Methylsulfonyl)phenyl]furan-2-carboxylic acid
- 2-Furancarboxylic acid, 5-[4-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
