CymitQuimica logo

CAS 893739-18-9

:

5-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid

Description:
5-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 893739-18-9, is an organic compound characterized by its complex structure that includes a pyridine ring and a carboxylic acid functional group. This compound features a phenylmethoxy group attached to a phenyl ring, contributing to its aromatic properties. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of pyridine derivatives to interact with biological targets. Additionally, the compound may exhibit interesting physical properties such as melting and boiling points, which are influenced by its molecular interactions and the presence of functional groups. Overall, 5-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid is a compound of interest for further research in various chemical and biological contexts.
Formula:C19H15NO3
InChI:InChI=1S/C19H15NO3/c21-19(22)17-10-16(11-20-12-17)15-6-8-18(9-7-15)23-13-14-4-2-1-3-5-14/h1-12H,13H2,(H,21,22)
InChI key:InChIKey=AFVYMXHOYMUQJF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C2=CC=C(OCC3=CC=CC=C3)C=C2
Synonyms:
  • 5-[4-(Phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-[4-(phenylmethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.