CAS 893739-65-6

1-[4′-(Phenylmethoxy)[1,1′-biphenyl]-2-yl]ethanone

Description:

1-[4′-(Phenylmethoxy)[1,1′-biphenyl]-2-yl]ethanone, with the CAS number 893739-65-6, is an organic compound characterized by its complex structure, which includes a biphenyl moiety and an ethanone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the phenylmethoxy group enhances its solubility in organic solvents while potentially influencing its reactivity and interaction with biological systems. It may also exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in materials science or pharmaceuticals. Additionally, the compound's structure suggests potential for various substitution reactions, which could be explored for further functionalization. As with many organic compounds, its behavior in different environments, including its stability under various conditions, would be essential for practical applications. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₂₁H₁₈O₂

InChI: InChI=1S/C21H18O2/c1-16(22)20-9-5-6-10-21(20)18-11-13-19(14-12-18)23-15-17-7-3-2-4-8-17/h2-14H,15H2,1H3

InChI key: InChIKey=HLJLKOQABAFVPT-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C=CC=C1)C2=CC=C(OCC3=CC=CC=C3)C=C2

Synonyms:

• 1-[4′-(Phenylmethoxy)[1,1′-biphenyl]-2-yl]ethanone
• Ethanone, 1-[4′-(phenylmethoxy)[1,1′-biphenyl]-2-yl]-