CAS 893739-85-0
:5-(2-fluorophenyl)pyridin-2-amine
Description:
5-(2-Fluorophenyl)pyridin-2-amine is an organic compound characterized by its pyridine and aniline functional groups. It features a pyridine ring substituted at the 2-position with an amino group and a phenyl group that is further substituted with a fluorine atom at the 2-position. This structure contributes to its potential as a bioactive molecule, often explored in medicinal chemistry for its pharmacological properties. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for drug development. The compound may exhibit various chemical properties, including solubility in organic solvents and potential reactivity due to the amino group, which can participate in hydrogen bonding and nucleophilic reactions. Its molecular interactions and biological activity can be influenced by the electronic effects of the fluorine substituent and the overall molecular geometry. As with many compounds in this class, safety and handling precautions should be observed, as it may pose health risks or environmental hazards.
Formula:C11H9FN2
InChI:InChI=1/C11H9FN2/c12-10-4-2-1-3-9(10)8-5-6-11(13)14-7-8/h1-7H,(H2,13,14)
SMILES:c1ccc(c(c1)c1ccc(=N)[nH]c1)F
Synonyms:- 2-Pyridinamine, 5-(2-fluorophenyl)-
- 5-(2-Fluorophenyl)pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.