CAS 89374-79-8
:9-methyl-9H-carbazole-3-carboxylic acid
Description:
9-Methyl-9H-carbazole-3-carboxylic acid is an organic compound characterized by its structure, which includes a carbazole moiety with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents, while the carbazole structure imparts potential for π-π stacking interactions, making it relevant in materials science and organic electronics. Additionally, 9-methyl-9H-carbazole-3-carboxylic acid may exhibit fluorescence, which can be advantageous in applications such as dye synthesis or as a fluorescent probe. Its molecular structure allows for various functionalization possibilities, making it a versatile building block in organic synthesis. Overall, this compound's unique combination of functional groups and aromatic characteristics makes it of interest in both academic research and industrial applications.
Formula:C14H11NO2
InChI:InChI=1/C14H11NO2/c1-15-12-5-3-2-4-10(12)11-8-9(14(16)17)6-7-13(11)15/h2-8H,1H3,(H,16,17)
SMILES:Cn1c2ccccc2c2cc(ccc12)C(=O)O
Synonyms:- 9H-carbazole-3-carboxylic acid, 9-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-Methyl-9H-carbazole-3-carboxylic Acid
CAS:Controlled ProductApplications 9-methyl-9H-carbazole-3-carboxylic acid (cas# 89374-79-8) is a useful research chemical.
Formula:C14H11NO2Color and Shape:NeatMolecular weight:225.243
