
CAS 89374-80-1
:Ethyl 9-methyl-9H-carbazole-2-carboxylate
Description:
Ethyl 9-methyl-9H-carbazole-2-carboxylate is an organic compound characterized by its carbazole structure, which is a fused ring system containing nitrogen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. It typically appears as a solid or viscous liquid, depending on the specific conditions. The presence of the methyl group at the 9-position of the carbazole ring influences its electronic properties, potentially enhancing its photophysical characteristics. Ethyl 9-methyl-9H-carbazole-2-carboxylate is of interest in various fields, including organic electronics and materials science, due to its potential applications in light-emitting devices and as a building block in organic synthesis. Its reactivity can be attributed to the carboxylate group, which can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C16H15NO2
InChI:InChI=1S/C16H15NO2/c1-3-19-16(18)11-8-9-13-12-6-4-5-7-14(12)17(2)15(13)10-11/h4-10H,3H2,1-2H3
InChI key:InChIKey=JZRXTFZKDOGOSH-UHFFFAOYSA-N
SMILES:CN1C=2C(C=3C1=CC=CC3)=CC=C(C(OCC)=O)C2
Synonyms:- Ethyl 9-methyl-9H-carbazole-2-carboxylate
- 9H-Carbazole-2-carboxylic acid, 9-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
