CymitQuimica logo

CAS 893747-38-1

:

1-(4-methoxybenzyl)piperazin-2-one

Description:
1-(4-Methoxybenzyl)piperazin-2-one, identified by its CAS number 893747-38-1, is a chemical compound that features a piperazine ring substituted with a methoxybenzyl group and a carbonyl group. This compound typically exhibits characteristics common to piperazine derivatives, such as potential psychoactive properties and interactions with various neurotransmitter systems. The presence of the methoxy group can enhance lipophilicity, influencing its pharmacokinetic properties, including absorption and distribution in biological systems. Additionally, the piperazine moiety is known for its ability to form hydrogen bonds, which may contribute to its biological activity. The compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of central nervous system disorders. However, detailed studies on its specific biological activities, toxicity, and therapeutic potential would be necessary to fully understand its implications in pharmacology. As with any chemical substance, proper handling and safety protocols should be observed due to potential health risks associated with exposure.
Formula:C12H16N2O2
InChI:InChI=1/C12H16N2O2/c1-16-11-4-2-10(3-5-11)9-14-7-6-13-8-12(14)15/h2-5,13H,6-9H2,1H3
SMILES:COc1ccc(cc1)CN1CCNCC1=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.