CymitQuimica logo

CAS 893747-85-8

:

1-(2-fluorobenzyl)piperazin-2-one

Description:
1-(2-Fluorobenzyl)piperazin-2-one is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a fluorobenzyl group at the 1-position and a carbonyl group at the 2-position contributes to its unique properties. This compound is typically classified as an organic molecule and may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems due to the piperazine moiety. The fluorine atom can enhance lipophilicity and metabolic stability, which may affect the compound's pharmacokinetics. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present. As with many piperazine derivatives, it may serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C11H13FN2O
InChI:InChI=1/C11H13FN2O/c12-10-4-2-1-3-9(10)8-14-6-5-13-7-11(14)15/h1-4,13H,5-8H2
SMILES:c1ccc(c(c1)CN1CCNCC1=O)F
Synonyms:
  • 2-Piperazinone, 1-[(2-Fluorophenyl)Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.