CAS 893750-56-6
:4-(aminomethyl)-1-cyclopentyl-pyrrolidin-2-one
Description:
4-(Aminomethyl)-1-cyclopentyl-pyrrolidin-2-one, identified by its CAS number 893750-56-6, is a chemical compound that belongs to the class of pyrrolidinones. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a cyclopentyl group and an aminomethyl group. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. The compound's structure indicates it may exhibit properties such as lipophilicity due to the cyclopentyl moiety, which can influence its biological activity and pharmacokinetics. Additionally, the presence of the carbonyl group in the pyrrolidinone structure may contribute to its reactivity and stability. Overall, this compound's unique structural features may render it useful in various applications, particularly in the synthesis of pharmaceuticals or as a research chemical in the study of neuroactive compounds. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c11-6-8-5-10(13)12(7-8)9-3-1-2-4-9/h8-9H,1-7,11H2
SMILES:C1CCC(C1)N1CC(CC1=O)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
