CymitQuimica logo

CAS 893750-67-9

:

3-chloro-4-(2-methylpiperidin-1-yl)aniline

Description:
3-Chloro-4-(2-methylpiperidin-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a piperidine moiety. The presence of the chloro group at the 3-position of the aniline ring contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The 2-methylpiperidine component enhances the compound's basicity and solubility in organic solvents, making it suitable for use in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Additionally, its molecular structure suggests potential for hydrogen bonding and steric interactions, influencing its behavior in different environments. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity associated with amines and halogenated compounds. Overall, 3-chloro-4-(2-methylpiperidin-1-yl)aniline is a versatile compound with significant implications in chemical synthesis and drug development.
Formula:C12H17ClN2
InChI:InChI=1/C12H17ClN2/c1-9-4-2-3-7-15(9)12-6-5-10(14)8-11(12)13/h5-6,8-9H,2-4,7,14H2,1H3
SMILES:CC1CCCCN1c1ccc(cc1Cl)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.