CAS 893750-70-4
:3-chloro-4-(3-methylpiperidin-1-yl)aniline
Description:
3-Chloro-4-(3-methylpiperidin-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a piperidine moiety. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and solubility. The piperidine ring, a six-membered nitrogen-containing heterocycle, contributes to the compound's basicity and potential for forming hydrogen bonds. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its molecular structure suggests it may exhibit properties such as moderate lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the presence of both the chloro and piperidine groups may enhance its interaction with biological targets, making it a candidate for further investigation in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C12H17ClN2
InChI:InChI=1/C12H17ClN2/c1-9-3-2-6-15(8-9)12-5-4-10(14)7-11(12)13/h4-5,7,9H,2-3,6,8,14H2,1H3
SMILES:CC1CCCN(C1)c1ccc(cc1Cl)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
