CAS 893750-77-1

1-(3-Aminopropyl)-5-oxo-3-pyrrolidinecarboxylic acid

Description:

1-(3-Aminopropyl)-5-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 893750-77-1, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the 5-oxo group indicates a carbonyl functionality, which can influence the compound's reactivity and interactions. Its structure suggests that it may participate in various biological processes, potentially acting as a precursor or intermediate in the synthesis of pharmaceuticals or other organic compounds. The amino and carboxylic acid groups also imply that it could engage in hydrogen bonding, affecting its solubility and stability in different solvents. Overall, this compound may have applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways, although specific biological activities would require further investigation.

Formula: C₈H₁₄N₂O₃

InChI: InChI=1S/C8H14N2O3/c9-2-1-3-10-5-6(8(12)13)4-7(10)11/h6H,1-5,9H2,(H,12,13)

InChI key: InChIKey=PGMWCYUUUCQPBZ-UHFFFAOYSA-N

SMILES: C(CCN)N1CC(C(O)=O)CC1=O

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-(3-aminopropyl)-5-oxo-
• 1-(3-Aminopropyl)-5-oxo-3-pyrrolidinecarboxylic acid