CAS 893750-99-7

5-Chloro-2-(3,4-dimethylphenoxy)benzenamine

Description:

5-Chloro-2-(3,4-dimethylphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine functional group. The presence of the chloro group indicates that it is a chlorinated compound, which can influence its reactivity and solubility. The dimethylphenoxy moiety suggests that the compound has a phenolic character, potentially contributing to its biological activity and interactions with other molecules. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its molecular structure allows for various applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The specific arrangement of substituents can affect its physical properties, such as melting point, boiling point, and solubility in different solvents. Additionally, the compound's safety and handling considerations would depend on its toxicity profile, which should be evaluated through appropriate safety data sheets and toxicological studies.

Formula: C₁₄H₁₄ClNO

InChI: InChI=1S/C14H14ClNO/c1-9-3-5-12(7-10(9)2)17-14-6-4-11(15)8-13(14)16/h3-8H,16H2,1-2H3

InChI key: InChIKey=HAPYNLVJSKJMPW-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=C(Cl)C=C1)C2=CC(C)=C(C)C=C2

Synonyms:

• Benzenamine, 5-chloro-2-(3,4-dimethylphenoxy)-
• 5-Chloro-2-(3,4-dimethylphenoxy)benzenamine