CAS 893751-41-2
:5-chloro-2-(3-methylpiperidin-1-yl)aniline
Description:
5-Chloro-2-(3-methylpiperidin-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a piperidine moiety. The presence of the chlorine atom at the 5-position of the aniline ring contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The 3-methylpiperidine group enhances the compound's basicity and solubility in polar solvents, making it suitable for use in pharmaceutical and agrochemical synthesis. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Additionally, its molecular structure suggests potential for further derivatization, allowing for the exploration of new compounds with desired properties. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 5-chloro-2-(3-methylpiperidin-1-yl)aniline is a versatile compound with significant implications in chemical research and development.
Formula:C12H17ClN2
InChI:InChI=1/C12H17ClN2/c1-9-3-2-6-15(8-9)12-5-4-10(13)7-11(12)14/h4-5,7,9H,2-3,6,8,14H2,1H3
SMILES:CC1CCCN(C1)c1ccc(cc1N)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
