CAS 893751-51-4

5-Chloro-2-(3,4-dihydro-2(1H)-isoquinolinyl)benzenamine

Description:

5-Chloro-2-(3,4-dihydro-2(1H)-isoquinolinyl)benzenamine, with the CAS number 893751-51-4, is a chemical compound characterized by its complex structure, which includes a chloro-substituted benzene ring and a dihydroisoquinoline moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity due to the presence of the isoquinoline structure, which is known for its role in various pharmacological applications. The chloro group can influence the compound's reactivity and solubility, while the amine functional group may contribute to its ability to form hydrogen bonds, affecting its interactions in biological systems. The compound's molecular weight, melting point, and solubility characteristics would be influenced by its specific functional groups and overall structure. As with many organic compounds, its stability and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound may be of interest in medicinal chemistry and drug development due to its unique structural features.

Formula: C₁₅H₁₅ClN₂

InChI: InChI=1S/C15H15ClN2/c16-13-5-6-15(14(17)9-13)18-8-7-11-3-1-2-4-12(11)10-18/h1-6,9H,7-8,10,17H2

InChI key: InChIKey=FCSWDZZDFCLQME-UHFFFAOYSA-N

SMILES: NC1=C(N2CC=3C(CC2)=CC=CC3)C=CC(Cl)=C1

Synonyms:

• 5-Chloro-2-(3,4-dihydro-2(1H)-isoquinolinyl)benzenamine
• Benzenamine, 5-chloro-2-(3,4-dihydro-2(1H)-isoquinolinyl)-