CAS 893754-09-1
:2-[2-(pyridin-2-yl)ethoxy]aniline
Description:
2-[2-(Pyridin-2-yl)ethoxy]aniline, with the CAS number 893754-09-1, is an organic compound characterized by its complex structure that includes an aniline moiety and a pyridine ring. This compound features an ethoxy group connecting the aniline and pyridine components, which contributes to its solubility and reactivity. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of both nitrogen-containing heterocycles and functional groups. The pyridine ring can participate in various chemical interactions, including hydrogen bonding and coordination with metal ions, making it useful in coordination chemistry and as a ligand. Additionally, the aniline part of the molecule can undergo electrophilic substitution reactions, which is characteristic of aromatic amines. The compound may also exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample.
Formula:C13H14N2O
InChI:InChI=1/C13H14N2O/c14-12-6-1-2-7-13(12)16-10-8-11-5-3-4-9-15-11/h1-7,9H,8,10,14H2
SMILES:c1ccc(c(c1)N)OCCc1ccccn1
Synonyms:- Benzenamine, 2-[2-(2-Pyridinyl)Ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2-[2-(2-Pyridinyl)ethoxy]phenyl)amine dihydrochloride
CAS:Formula:C13H14N2OMolecular weight:214.2631
