CAS 893762-15-7
:8-methylquinolin-4-amine
Description:
8-Methylquinolin-4-amine, identified by its CAS number 893762-15-7, is an organic compound belonging to the class of quinolines, which are bicyclic aromatic compounds. This particular compound features a methyl group at the 8-position and an amino group at the 4-position of the quinoline ring system. It is characterized by its potential biological activity, which may include antimicrobial or antitumor properties, making it of interest in medicinal chemistry. The presence of the amino group enhances its solubility in polar solvents and may facilitate interactions with biological targets. Additionally, the quinoline structure is known for its ability to chelate metal ions, which can be relevant in various chemical and biological applications. The compound's molecular structure contributes to its reactivity and stability, influencing its behavior in different environments. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances.
Formula:C10H10N2
InChI:InChI=1/C10H10N2/c1-7-3-2-4-8-9(11)5-6-12-10(7)8/h2-6H,1H3,(H2,11,12)
SMILES:Cc1cccc2c(=N)cc[nH]c12
Synonyms:- 4-Quinolinamine, 8-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
