CAS 893764-75-5
:2-Methyl-1-(2,3,4,5,6-pentafluorophenoxy)-2-propanamine
Description:
2-Methyl-1-(2,3,4,5,6-pentafluorophenoxy)-2-propanamine is a chemical compound characterized by its unique structure, which includes a branched amine group and a highly fluorinated aromatic moiety. The presence of five fluorine atoms on the phenyl ring significantly enhances the compound's lipophilicity and alters its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The methyl and propanamine groups contribute to its steric and electronic characteristics, influencing its reactivity and interaction with biological systems. This compound may exhibit interesting biological activities due to the fluorinated phenyl group, which can affect binding affinity and selectivity in biological targets. Additionally, the stability of the fluorinated structure can enhance the compound's resistance to metabolic degradation. Overall, 2-Methyl-1-(2,3,4,5,6-pentafluorophenoxy)-2-propanamine represents a class of compounds that are of interest for their unique properties and potential applications in various fields of research and industry.
Formula:C10H10F5NO
InChI:InChI=1S/C10H10F5NO/c1-10(2,16)3-17-9-7(14)5(12)4(11)6(13)8(9)15/h3,16H2,1-2H3
InChI key:InChIKey=OOGWLMYBYIPVKA-UHFFFAOYSA-N
SMILES:O(CC(C)(C)N)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- 2-Propanamine, 2-methyl-1-(2,3,4,5,6-pentafluorophenoxy)-
- 2-Methyl-1-(2,3,4,5,6-pentafluorophenoxy)-2-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.