CAS 893773-96-1
:methyl 6-amino-3,4-dihydroquinoline-1(2H)-carboxylate
Description:
Methyl 6-amino-3,4-dihydroquinoline-1(2H)-carboxylate, with the CAS number 893773-96-1, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of an amino group enhances its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The dihydroquinoline moiety indicates that it has a saturated ring system, which can influence its physical properties, such as solubility and stability. Methyl 6-amino-3,4-dihydroquinoline-1(2H)-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced properties. Overall, this compound represents a versatile scaffold in organic chemistry and drug development, with potential implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H14N2O2
InChI:InChI=1/C11H14N2O2/c1-15-11(14)13-6-2-3-8-7-9(12)4-5-10(8)13/h4-5,7H,2-3,6,12H2,1H3
SMILES:COC(=O)N1CCCc2cc(ccc12)N
Synonyms:- 1(2H)-quinolinecarboxylic acid, 6-amino-3,4-dihydro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 6-amino-3,4-dihydroquinoline-1(2H)-carboxylate
CAS:Formula:C11H14N2O2Molecular weight:206.2411
