CymitQuimica logo

CAS 893779-10-7

:

2-(4-acetylpiperazin-1-yl)-3-chloroaniline

Description:
2-(4-acetylpiperazin-1-yl)-3-chloroaniline is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with an acetyl group and an aniline moiety with a chlorine atom at the meta position. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the piperazine and amine functionalities. The acetyl group can influence the compound's reactivity and stability, while the chloro substituent may affect its electronic properties and interactions with biological targets. As a result, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H16ClN3O
InChI:InChI=1/C12H16ClN3O/c1-9(17)15-5-7-16(8-6-15)12-10(13)3-2-4-11(12)14/h2-4H,5-8,14H2,1H3
SMILES:CC(=O)N1CCN(CC1)c1c(cccc1N)Cl
Synonyms:
  • 1-[4-(2-Amino-6-Chlorophenyl)Piperazin-1-Yl]Ethanone
  • Ethanone, 1-[4-(2-Amino-6-Chlorophenyl)-1-Piperazinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.