CAS 89380-30-3
:1,3-Cyclobutanedicarbonyl dichloride
Description:
1,3-Cyclobutanedicarbonyl dichloride, with the CAS number 89380-30-3, is a chemical compound characterized by its unique cyclic structure and the presence of two carbonyl groups and two chlorine substituents. This compound features a cyclobutane ring, which consists of four carbon atoms arranged in a square planar configuration, contributing to its rigidity and strain. The dichloride functional groups indicate that each carbonyl carbon is bonded to a chlorine atom, enhancing its reactivity, particularly in nucleophilic substitution reactions. The presence of carbonyl groups suggests that it can participate in various chemical transformations, making it useful in organic synthesis. Additionally, the compound is likely to be a solid at room temperature, exhibiting moderate stability under standard conditions, but it may be sensitive to moisture and light. Proper handling and storage are essential due to its potential reactivity and the hazardous nature of the chlorine substituents. Overall, 1,3-Cyclobutanedicarbonyl dichloride is a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C6H6Cl2O2
InChI:InChI=1S/C6H6Cl2O2/c7-5(9)3-1-4(2-3)6(8)10/h3-4H,1-2H2
InChI key:InChIKey=AKNSPOIOVXTGSF-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1CC(C(Cl)=O)C1
Synonyms:- 1,3-Cyclobutanedicarbonyl dichloride
- 1,3-Cyclobutanedicarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
