CAS 89381-13-5

2-aminocyclopentanol

Description:

2-Aminocyclopentanol is an organic compound characterized by its cyclopentane ring structure with an amino group and a hydroxyl group attached to it. This compound features a five-membered carbon ring, which contributes to its unique cyclic properties. The presence of the amino group (-NH2) makes it a primary amine, while the hydroxyl group (-OH) classifies it as an alcohol. This dual functionality allows 2-aminocyclopentanol to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can influence its solubility and reactivity. Typically, it is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is of interest in organic synthesis and medicinal chemistry, as it may serve as a building block for more complex molecules or as a potential pharmaceutical agent. Its properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.

Formula: C₅H₁₁NO

InChI: InChI=1/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2/t4-,5+/m1/s1

Synonyms:

• Cyclopentanol, 2-Amino-
• 2-Aminocyclopentanol

2-Aminocyclopentanol

CAS: 89381-13-5

Formula: C₅H₁₁NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 101.1469

Ref: IN-DA006396

2-Aminocyclopentanol

CAS: 89381-13-5

2-Aminocyclopentanol

Purity: 95%

Molecular weight: 101.149g/mol

Ref: 54-OR73338

2-Aminocyclopentanol

CAS: 89381-13-5

Formula: C₅H₁₁NO

Purity: 97%

Color and Shape: Yellow liquid

Molecular weight: 101.149

Ref: 10-F070470

2-Amino cyclopentanol

Controlled Product

CAS: 89381-13-5

Applications 2-Amino cyclopentanol

Formula: C₅H₁₁NO

Color and Shape: Neat

Molecular weight: 101.147

Ref: TR-A596510