CAS 89391-74-2
:Carbamic acid, [(6-chloro-3-pyridazinyl)sulfonyl]-, phenyl ester
Description:
Carbamic acid, [(6-chloro-3-pyridazinyl)sulfonyl]-, phenyl ester, identified by CAS number 89391-74-2, is a chemical compound that features a carbamic acid functional group linked to a phenyl ester moiety. This compound is characterized by the presence of a pyridazine ring, which contributes to its unique chemical properties. The sulfonyl group enhances its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the chloro substituent on the pyridazine ring can influence the compound's electronic properties and potential interactions with biological targets. Additionally, the ester linkage suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding phenol and carbamic acid. Overall, this compound's structure suggests potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, although specific biological activities would require further investigation.
Formula:C11H8ClN3O4S
InChI:InChI=1S/C11H8ClN3O4S/c12-9-6-7-10(14-13-9)20(17,18)15-11(16)19-8-4-2-1-3-5-8/h1-7H,(H,15,16)
InChI key:InChIKey=AXLVJKRDQCPNIZ-UHFFFAOYSA-N
SMILES:S(NC(OC1=CC=CC=C1)=O)(=O)(=O)C2=CC=C(Cl)N=N2
Synonyms:- Carbamic acid, [(6-chloro-3-pyridazinyl)sulfonyl]-, phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
