
CAS 89391-77-5
:3-Methoxy-2-pyrazinesulfonamide
Description:
3-Methoxy-2-pyrazinesulfonamide is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a methoxy group (-OCH3) at the 3-position of the pyrazine ring contributes to its solubility and reactivity, while the sulfonamide group (-SO2NH2) at the 2-position enhances its potential as a bioactive molecule. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. It is often utilized in medicinal chemistry for its potential pharmacological properties, including antibacterial and antifungal activities. The sulfonamide moiety is known for its role in various therapeutic agents, particularly in the treatment of bacterial infections. Additionally, the compound's structure allows for various chemical modifications, which can lead to the development of derivatives with enhanced biological activity or selectivity. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 3-Methoxy-2-pyrazinesulfonamide should be evaluated in the context of its intended use.
Formula:C5H7N3O3S
InChI:InChI=1S/C5H7N3O3S/c1-11-4-5(12(6,9)10)8-3-2-7-4/h2-3H,1H3,(H2,6,9,10)
InChI key:InChIKey=PDKBUMPZEFGXGF-UHFFFAOYSA-N
SMILES:O(C)C=1C(S(N)(=O)=O)=NC=CN1
Synonyms:- Pyrazinesulfonamide, 3-methoxy-
- 2-Pyrazinesulfonamide, 3-methoxy-
- 3-Methoxy-2-pyrazinesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.