CAS 89399-92-8

2-phenyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-amine

Description:

2-Phenyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-amine is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. This compound features a phenyl group attached to the tetrahydrocyclopentane structure, contributing to its aromatic properties. The presence of an amine functional group indicates potential for hydrogen bonding and reactivity, making it of interest in various chemical applications, including medicinal chemistry. The compound's molecular structure suggests it may exhibit specific biological activities, potentially influencing its pharmacological profile. Its CAS number, 89399-92-8, allows for easy identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 2-phenyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-amine represents a complex structure that may serve as a valuable scaffold in drug development and other chemical research endeavors.

Formula: C₁₂H₁₃N₃

InChI: InChI=1/C12H13N3/c13-12-10-7-4-8-11(10)14-15(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,13H2

SMILES: c1ccc(cc1)n1c(c2CCCc2n1)N

2-Phenyl-4H,5H,6H-cyclopenta[c]pyrazol-3-amine

CAS: 89399-92-8

Formula: C₁₂H₁₃N₃

Molecular weight: 199.2517

Ref: IN-DA003WJK

2-Phenyl-4H,5H,6H-cyclopenta[c]pyrazol-3-amine

CAS: 89399-92-8

2-Phenyl-4H,5H,6H-cyclopenta[c]pyrazol-3-amine

Purity: 95%

Ref: 54-OR1038489

2-phenyl-4H,5H,6H-cyclopenta[c]pyrazol-3-amine

CAS: 89399-92-8

Molecular weight: 199.25700378418

Ref: 10-F871504