CymitQuimica logo

CAS 894-86-0

:

[2,2′-Bi-1H-indole]-3,3′-diol, sodium salt (1:2)

Description:
[2,2′-Bi-1H-indole]-3,3′-diol, sodium salt (1:2), with the CAS number 894-86-0, is a chemical compound that features a biphenyl structure with indole moieties. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity and solubility in polar solvents due to the presence of hydroxyl groups and the sodium salt form. The sodium salt form enhances its solubility in aqueous environments, making it useful in various applications, including pharmaceuticals and biochemical research. The compound may exhibit antioxidant properties and could interact with biological systems, potentially influencing various metabolic pathways. Its structural characteristics allow for various functionalizations, which can be explored for developing new therapeutic agents. As with many indole derivatives, it may also display fluorescence properties, making it suitable for use in imaging or sensing applications. Overall, this compound represents a versatile structure with potential implications in medicinal chemistry and materials science.
Formula:C16H12N2O2·2Na
InChI:InChI=1S/C16H12N2O2.2Na/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14;;/h1-8,17-20H;;
InChI key:InChIKey=POWDRPGIQAQPDR-UHFFFAOYSA-N
SMILES:OC1=C(NC=2C1=CC=CC2)C3=C(O)C=4C(N3)=CC=CC4.[Na]
Synonyms:
  • [2,2′-Bi-1H-indole]-3,3′-diol, disodium salt
  • [2,2′-Biindole]-3,3′-diol, disodium salt
  • [2,2′-Bi-1H-indole]-3,3′-diol, sodium salt (1:2)
  • C.I. 73001
  • Indigo white
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.