CAS 89401-55-8
:4-Methyl-2-(4-pyridinyl)-5-thiazolecarboxamide
Description:
4-Methyl-2-(4-pyridinyl)-5-thiazolecarboxamide, with the CAS number 89401-55-8, is a chemical compound characterized by its thiazole and pyridine functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its biological activity. The presence of the pyridine ring enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. The methyl group at the 4-position of the thiazole ring can influence the compound's solubility and reactivity. Typically, compounds like this may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its behavior in different environments. As with many heterocyclic compounds, the synthesis and characterization of 4-Methyl-2-(4-pyridinyl)-5-thiazolecarboxamide would involve standard organic chemistry techniques, including purification and spectroscopic analysis to confirm its identity and purity.
Formula:C10H9N3OS
InChI:InChI=1S/C10H9N3OS/c1-6-8(9(11)14)15-10(13-6)7-2-4-12-5-3-7/h2-5H,1H3,(H2,11,14)
InChI key:InChIKey=ZVPOPADEGMXCIO-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1SC(=NC1C)C=2C=CN=CC2
Synonyms:- 5-Thiazolecarboxamide, 4-methyl-2-(4-pyridinyl)-
- 4-Methyl-2-(4-pyridinyl)-5-thiazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
