
CAS 89401-58-1
:N-Methyl-2-(4-pyridinyl)-4-thiazolecarboxamide
Description:
N-Methyl-2-(4-pyridinyl)-4-thiazolecarboxamide, identified by its CAS number 89401-58-1, is a chemical compound characterized by its thiazole and pyridine functional groups. This compound typically exhibits a molecular structure that includes a thiazole ring, which is a five-membered heterocyclic ring containing sulfur and nitrogen, and a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom. The presence of the N-methyl group suggests that it has a methyl substituent on the nitrogen atom, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its characteristics, such as melting point, solubility, and reactivity, would depend on the specific conditions and environment in which it is studied. Additionally, the compound's interactions with biological systems could be significant, warranting further investigation into its potential applications in drug development or other fields.
Formula:C10H9N3OS
InChI:InChI=1S/C10H9N3OS/c1-11-9(14)8-6-15-10(13-8)7-2-4-12-5-3-7/h2-6H,1H3,(H,11,14)
InChI key:InChIKey=ANRNYGXDGQPCFT-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1N=C(SC1)C=2C=CN=CC2
Synonyms:- 4-Thiazolecarboxamide, N-methyl-2-(4-pyridinyl)-
- N-Methyl-2-(4-pyridinyl)-4-thiazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
