CAS 89402-42-6

2,3-Difluoro-5-(trifluoromethyl)pyridine

Description:

2,3-Difluoro-5-(trifluoromethyl)pyridine is a fluorinated heterocyclic compound characterized by the presence of a pyridine ring substituted with two fluorine atoms at the 2 and 3 positions and a trifluoromethyl group at the 5 position. This compound is notable for its high electronegativity due to the fluorine substituents, which can significantly influence its chemical reactivity and physical properties. It typically exhibits a high boiling point and low solubility in water, making it more soluble in organic solvents. The presence of multiple fluorine atoms enhances its stability and can impart unique properties, such as increased lipophilicity and potential applications in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms, which can affect its behavior in chemical reactions and interactions with biological systems. Overall, 2,3-Difluoro-5-(trifluoromethyl)pyridine is a valuable compound in synthetic chemistry and material science.

Formula: C₆H₂F₅N

InChI: InChI=1S/C6H2F5N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H

InChI key: InChIKey=XIFCGIKPAAZFFS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(F)C(F)=NC1

Synonyms:

• Ethyl 3-Oxo-3-[2-(Trifluoromethyl)Phenyl]Propanoate
• Pyridine, 2,3-difluoro-5-(trifluoromethyl)-
• 2,3-Difluoro-5-(trifluoromethyl)pyridine

2,3-DIFLUORO-5-(TRIFLUOROMETHYL)PYRIDINE

CAS: 89402-42-6

Formula: C₆H₂F₅N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 183.0788

Ref: IN-DA003FIB

2,3-Difluoro-5-(trifluoromethyl)pyridine

CAS: 89402-42-6

2,3-Difluoro-5-(trifluoromethyl)pyridine

Formula: C₆H₂F₅N

Purity: ≥95%

Color and Shape: colourless liquid

Molecular weight: 183.08g/mol

Ref: 54-PC9478

2,3-Difluoro-5-(trifluoromethyl)pyridine

CAS: 89402-42-6

Formula: C₆H₂F₅N

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 183.08

Ref: 3B-D4623

2,3-Difluoro-5-trifluoromethylpyridine

CAS: 89402-42-6

Formula: C₆H₂F₅N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 183.081

Ref: 10-F033034

2,3-Difluoro-5-(trifluoromethyl)pyridine

CAS: 89402-42-6

2,3-Difluoro-5-(trifluoromethyl)pyridine is a diluent that is used in organic synthesis. It is a nucleophilic and hydrogen fluoride (HF) activated fluoropyridine. This compound has a diameter of 190.7 pm and an anhydrous form. 2,3-Difluoro-5-(trifluoromethyl)pyridine can be prepared by condensing pyridine with fluorine gas in the presence of an activating agent such as HF or silver nitrate. This compound reacts when exposed to vapor or heat, releasing HF as a byproduct. The pyridine ring found in this compound contains six carbon atoms, two nitrogen atoms, and one oxygen atom.

Formula: C₆H₂F₅N

Purity: Min. 95%

Molecular weight: 183.08 g/mol

Ref: 3D-FD75484