
CAS 89405-45-8
:4,5-Bis(4-chlorophenyl)-2-thiazolamine
Description:
4,5-Bis(4-chlorophenyl)-2-thiazolamine, with the CAS number 89405-45-8, is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features two 4-chlorophenyl groups attached to the thiazole, contributing to its potential biological activity and chemical stability. The presence of chlorine substituents on the phenyl rings can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Typically, thiazole derivatives are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 4,5-Bis(4-chlorophenyl)-2-thiazolamine represents a class of compounds with potential applications in medicinal chemistry and material science.
Formula:C15H10Cl2N2S
InChI:InChI=1S/C15H10Cl2N2S/c16-11-5-1-9(2-6-11)13-14(20-15(18)19-13)10-3-7-12(17)8-4-10/h1-8H,(H2,18,19)
InChI key:InChIKey=JKYJLVSUKREJNK-UHFFFAOYSA-N
SMILES:NC1=NC(=C(S1)C2=CC=C(Cl)C=C2)C3=CC=C(Cl)C=C3
Synonyms:- 2-Thiazolamine, 4,5-bis(4-chlorophenyl)-
- 4,5-Bis(4-chlorophenyl)-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
