CAS 89406-16-6
:3-(4-Hydroxy-3-methoxyphenyl)-1-phenyl-2-propen-1-one
Description:
3-(4-Hydroxy-3-methoxyphenyl)-1-phenyl-2-propen-1-one, commonly known as a derivative of chalcone, is an organic compound characterized by its conjugated double bond system and the presence of hydroxyl and methoxy functional groups. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of the hydroxyl group enhances its reactivity and solubility in polar solvents, while the methoxy group can influence its electronic properties and stability. The compound's structure allows for resonance stabilization, contributing to its chemical reactivity. It is often studied in the context of medicinal chemistry and natural product synthesis, where its derivatives may serve as lead compounds for drug development. Additionally, its unique structural features make it a subject of interest in various fields, including organic synthesis and materials science. As with many organic compounds, its behavior can be influenced by environmental factors such as pH and temperature.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-19-16-11-12(8-10-15(16)18)7-9-14(17)13-5-3-2-4-6-13/h2-11,18H,1H3
InChI key:InChIKey=SFDANOZEVFTUOG-UHFFFAOYSA-N
SMILES:C(=CC(=O)C1=CC=CC=C1)C2=CC(OC)=C(O)C=C2
Synonyms:- 1-Phenyl-3-(4-hydroxy-3-methoxyphenyl)-2-propen-1-one
- Chalcone, 4-hydroxy-3-methoxy-
- 3-(4-Hydroxy-3-methoxy-phenyl)-1-phenyl-propenone
- 3-(4-Hydroxy-3-methoxyphenyl)-1-phenyl-2-propen-1-one
- 2-Propen-1-one, 3-(4-hydroxy-3-methoxyphenyl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
