CAS 89407-25-0

[4-(Ethylthio)phenyl]phenylmethanone

Description:

[4-(Ethylthio)phenyl]phenylmethanone, with the CAS number 89407-25-0, is an organic compound that belongs to the class of ketones and is characterized by the presence of both a phenyl group and an ethylthio substituent. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic nature. The ethylthio group introduces a sulfur atom into the molecular structure, which can influence the compound's reactivity and potential applications in organic synthesis or as a building block in pharmaceuticals. The presence of the ketone functional group suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the compound's aromatic rings contribute to its stability and may affect its electronic properties, making it of interest in materials science and organic electronics. Overall, [4-(Ethylthio)phenyl]phenylmethanone is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₅H₁₄OS

InChI: InChI=1S/C15H14OS/c1-2-17-14-10-8-13(9-11-14)15(16)12-6-4-3-5-7-12/h3-11H,2H2,1H3

InChI key: InChIKey=NANYNGAUTNBYKH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(SCC)C=C1)C2=CC=CC=C2

Synonyms:

• [4-(Ethylsulfanyl)phenyl](phenyl)methanone
• [4-(Ethylthio)phenyl]phenylmethanone
• Methanone, [4-(ethylthio)phenyl]phenyl-

[4-(Ethylthio)phenyl]phenylmethanone

CAS: 89407-25-0

Formula: C₁₅H₁₄OS

Molecular weight: 242.3361

Ref: IN-DA003VSS