CAS 89407-44-3

2-Ethoxy-4-(methylthio)benzoic acid

Description:

2-Ethoxy-4-(methylthio)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an ethoxy group and a methylthio group. The presence of the ethoxy group contributes to its solubility in organic solvents, while the carboxylic acid functional group imparts acidic properties. This compound typically exhibits moderate to low volatility and may have a relatively low melting point, characteristic of many substituted benzoic acids. Its methylthio substituent can influence its reactivity and biological activity, potentially making it useful in various applications, including pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential interactions with biological systems, which may be of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-Ethoxy-4-(methylthio)benzoic acid is a versatile compound with unique properties stemming from its functional groups.

Formula: C₁₀H₁₂O₃S

InChI: InChI=1S/C10H12O3S/c1-3-13-9-6-7(14-2)4-5-8(9)10(11)12/h4-6H,3H2,1-2H3,(H,11,12)

InChI key: InChIKey=LMKXRAWKNZUBHY-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C(O)=O)C=CC(SC)=C1

Synonyms:

• 2-Ethoxy-4-(methylsulfanyl)benzoic acid
• 2-Ethoxy-4-(methylthio)benzoic acid
• Benzoic acid, 2-ethoxy-4-(methylthio)-