
CAS 894074-83-0
:2-Pyridinecarboxylic acid, 3-chloro-6-methyl-, methyl ester
Description:
2-Pyridinecarboxylic acid, 3-chloro-6-methyl-, methyl ester, also known by its CAS number 894074-83-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid group that has been esterified with methanol, resulting in a methyl ester. The presence of a chlorine atom at the 3-position and a methyl group at the 6-position of the pyridine ring contributes to its unique chemical properties and reactivity. Typically, such compounds exhibit moderate polarity due to the functional groups, which can influence their solubility in various solvents. They may also participate in various chemical reactions, including nucleophilic substitutions and esterification processes. The compound's potential applications could span across pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-5-3-4-6(9)7(10-5)8(11)12-2/h3-4H,1-2H3
InChI key:InChIKey=XUIMSHWQPOAENN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(Cl)C=CC(C)=N1
Synonyms:- Methyl 3-chloro-6-methyl-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 3-chloro-6-methyl-, methyl ester
- Methyl 3-chloro-6-methylpicolinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

