CymitQuimica logo

CAS 894074-88-5

:

Methyl 2-(bromomethyl)-5-chloro-3-pyridinecarboxylate

Description:
Methyl 2-(bromomethyl)-5-chloro-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a bromomethyl group and a chloro substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and esterifications. Its molecular structure suggests that it may exhibit polar characteristics due to the electronegative halogen atoms, which can influence its solubility in polar solvents. Additionally, the compound may have biological activity, making it of interest in pharmaceutical research. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, Methyl 2-(bromomethyl)-5-chloro-3-pyridinecarboxylate is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C8H7BrClNO2
InChI:InChI=1S/C8H7BrClNO2/c1-13-8(12)6-2-5(10)4-11-7(6)3-9/h2,4H,3H2,1H3
InChI key:InChIKey=OBVDYOHLYOSTAP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CBr)N=CC(Cl)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 2-(bromomethyl)-5-chloro-, methyl ester
  • Methyl 2-(bromomethyl)-5-chloro-3-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.