
CAS 89414-51-7
:4-Methoxy-1-[2-(trimethylsilyl)ethynyl]-2-[[(trimethylsilyl)oxy]methyl]benzene
Description:
4-Methoxy-1-[2-(trimethylsilyl)ethynyl]-2-[[(trimethylsilyl)oxy]methyl]benzene, with the CAS number 89414-51-7, is an organic compound characterized by its complex structure that includes a methoxy group, ethynyl group, and trimethylsilyl functionalities. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to undergo electrophilic substitution reactions. The presence of the trimethylsilyl groups enhances its solubility in organic solvents and can provide protection for reactive functional groups during synthetic transformations. Additionally, the ethynyl group contributes to its potential reactivity, allowing for further derivatization. This compound may be utilized in various applications, including organic synthesis and materials science, particularly in the development of advanced polymers or as intermediates in the synthesis of more complex molecules. Its unique combination of functional groups makes it a valuable building block in organic chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe usage in laboratory settings.
Formula:C16H26O2Si2
InChI:InChI=1S/C16H26O2Si2/c1-17-16-9-8-14(10-11-19(2,3)4)15(12-16)13-18-20(5,6)7/h8-9,12H,13H2,1-7H3
InChI key:InChIKey=WVURQFILKYTJPB-UHFFFAOYSA-N
SMILES:C(O[Si](C)(C)C)C1=C(C#C[Si](C)(C)C)C=CC(OC)=C1
Synonyms:- 4-Methoxy-1-[2-(trimethylsilyl)ethynyl]-2-[[(trimethylsilyl)oxy]methyl]benzene
- Benzene, 4-methoxy-1-[2-(trimethylsilyl)ethynyl]-2-[[(trimethylsilyl)oxy]methyl]-
- Silane, [[5-methoxy-2-[(trimethylsilyl)ethynyl]phenyl]methoxy]trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Silane, [[5-methoxy-2-[(trimethylsilyl)ethynyl]phenyl]methoxy]trimethyl-
CAS:Formula:C16H26O2Si2Molecular weight:306.5474
