
CAS 89415-69-0
:1,2-Bis(2-bromoethyl) ethanedioate
Description:
1,2-Bis(2-bromoethyl) ethanedioate, with the CAS number 89415-69-0, is an organic compound characterized by its structure, which includes two bromoethyl groups attached to a central ethanedioate (oxalic acid diester) moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of bromine atoms, which can participate in nucleophilic substitution reactions. The ethanedioate part of the molecule contributes to its potential as a diester, making it useful in various chemical syntheses and applications, including as an intermediate in organic synthesis. Additionally, the presence of bromine enhances its utility in cross-coupling reactions and as a building block in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks due to its brominated nature and potential toxicity.
Formula:C6H8Br2O4
InChI:InChI=1S/C6H8Br2O4/c7-1-3-11-5(9)6(10)12-4-2-8/h1-4H2
InChI key:InChIKey=GJKUEAJIJQTAKF-UHFFFAOYSA-N
SMILES:C(C(OCCBr)=O)(OCCBr)=O
Synonyms:- Ethanedioic acid, 1,2-bis(2-bromoethyl) ester
- 1,2-Bis(2-bromoethyl) ethanedioate
- NSC 51580
- Oxalic acid, bis(2-bromoethyl) ester
- Ethanedioic acid, bis(2-bromoethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
