CymitQuimica logo

CAS 89417-84-5

:

3-ethoxy-5-methyl-1H-1,2,4-triazole

Description:
3-Ethoxy-5-methyl-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential fungicidal and herbicidal activities, making it of interest in agricultural applications. The presence of the ethoxy group enhances its solubility in organic solvents, while the methyl group contributes to its overall hydrophobic character. The compound's molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and biological activity. Additionally, 3-ethoxy-5-methyl-1H-1,2,4-triazole may undergo various chemical reactions, including substitution and oxidation, depending on the conditions. Its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, this compound is significant in the field of agrochemicals and may have applications in crop protection and management.
Formula:C5H9N3O
InChI:InChI=1/C5H9N3O/c1-3-9-5-6-4(2)7-8-5/h3H2,1-2H3,(H,6,7,8)
SMILES:CCOc1nc(C)[nH]n1
Synonyms:
  • 3-Ethoxy-5-methyl-4H-1,2,4-triazole
  • 4H-1,2,4-Triazole, 3-ethoxy-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.