CymitQuimica logo

CAS 89418-10-0

:

7-aminopyrazolo[1,5-a]pyrimidin-5(4H)-one

Description:
7-Aminopyrazolo[1,5-a]pyrimidin-5(4H)-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrazole ring fused to a pyrimidine ring. This compound features an amino group at the 7-position and a carbonyl group at the 5-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential as a pharmacological agent, as it may interact with various biological targets. Its structure allows for the possibility of forming hydrogen bonds, which can influence its interactions with enzymes or receptors. Additionally, the presence of nitrogen atoms in the rings can contribute to its basicity and overall chemical behavior. As with many heterocycles, the compound's properties can be influenced by substituents and the specific conditions under which it is synthesized or utilized.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c7-4-3-6(11)9-5-1-2-8-10(4)5/h1-3H,7H2,(H,9,11)
SMILES:c1cnn2c(cc(=O)[nH]c12)N
Synonyms:
  • 7-Aminopyrazolo[1,5-a]pyrimidin-5-ol
  • Pyrazolo[1,5-A]Pyrimidin-5-Ol, 7-Amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.