CymitQuimica logo

CAS 89418-11-1

:

1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-d]pyrimidin-3-one

Description:
1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-d]pyrimidin-3-one, with the CAS number 89418-11-1, is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure. This compound features a fused ring system that includes both pyrazole and pyrimidine moieties, contributing to its potential biological activity. It typically appears as a solid at room temperature and is soluble in various organic solvents. The presence of the methyl group and the carbonyl functional group in its structure can influence its reactivity and interactions with biological targets. Compounds of this class are often investigated for their pharmacological properties, including anti-inflammatory and anti-cancer activities. The specific characteristics such as melting point, boiling point, and spectral data (NMR, IR, MS) would provide further insights into its physical and chemical properties, but these details are typically obtained through experimental methods or literature sources. Overall, 1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-d]pyrimidin-3-one represents a significant compound in medicinal chemistry research.
Formula:C6H6N4O
InChI:InChI=1S/C6H6N4O/c1-10-5-4(6(11)9-10)2-7-3-8-5/h2-3H,1H3,(H,9,11)
InChI key:InChIKey=GOGWIEYQVGBUEO-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C)N1)=NC=NC2
Synonyms:
  • 3H-Pyrazolo[3,4-d]pyrimidin-3-one, 1,2-dihydro-1-methyl-
  • 1,2-Dihydro-1-methyl-3H-pyrazolo[3,4-d]pyrimidin-3-one
  • 1-Methyl-1H-pyrazolo[3,4-d]pyrimidin-3-ol
  • 1H-Pyrazolo[3,4-d]pyrimidin-3-ol, 1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.