CymitQuimica logo

CAS 894207-03-5

:

2,4-dimethyl-5-[(4-methyl-1-piperidyl)methyl]benzaldehyde

Description:
2,4-Dimethyl-5-[(4-methyl-1-piperidyl)methyl]benzaldehyde, with the CAS number 894207-03-5, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a benzene ring substituted with two methyl groups at the 2 and 4 positions, enhancing its hydrophobic character. The presence of a piperidine moiety, specifically a 4-methyl-1-piperidyl group, introduces basic nitrogen functionality, which can influence its reactivity and solubility in various solvents. The aldehyde functional group is known for its reactivity in condensation reactions and can participate in nucleophilic addition reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 2,4-dimethyl-5-[(4-methyl-1-piperidyl)methyl]benzaldehyde is a complex molecule with potential applications in various chemical and pharmaceutical contexts.
Formula:C16H23NO
InChI:InChI=1/C16H23NO/c1-12-4-6-17(7-5-12)10-15-9-16(11-18)14(3)8-13(15)2/h8-9,11-12H,4-7,10H2,1-3H3
SMILES:CC1CCN(CC1)Cc1cc(C=O)c(C)cc1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.