CAS 89426-98-2

4-bromo-6-fluoro-2-(trifluoromethyl)-1H-benzimidazole

Description:

4-Bromo-6-fluoro-2-(trifluoromethyl)-1H-benzimidazole is a heterocyclic organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of bromine and fluorine substituents at specific positions on the aromatic ring contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The trifluoromethyl group enhances its electron-withdrawing characteristics, which can influence reactivity and solubility. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive molecule. Its structural features may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of multiple halogen atoms can affect the compound's stability and reactivity, making it suitable for various synthetic applications. Overall, 4-bromo-6-fluoro-2-(trifluoromethyl)-1H-benzimidazole is a versatile compound with significant implications in chemical and pharmaceutical research.

Formula: C₈H₃BrF₄N₂

InChI: InChI=1/C8H3BrF4N2/c9-4-1-3(10)2-5-6(4)15-7(14-5)8(11,12)13/h1-2H,(H,14,15)

SMILES: c1c(cc2c(c1Br)[nH]c(C(F)(F)F)n2)F

4-Bromo-6-fluoro -2-(trifluoromethyl)-1H-benzimidazole

CAS: 89426-98-2

4-Bromo-6-fluoro -2-(trifluoromethyl)-1H-benzimidazole

Purity: ≥95%

Molecular weight: 283.02g/mol

Ref: 54-PC501010