CAS 89433-48-7

N-(1-Methylpropyl)-1-piperazineacetamide

Description:

N-(1-Methylpropyl)-1-piperazineacetamide, with the CAS number 89433-48-7, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered cyclic amine, and is substituted with an acetamide group and a 1-methylpropyl chain. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically characterized by its moderate polarity, which influences its solubility in various solvents, and it may exhibit basic properties due to the presence of the piperazine nitrogen atoms. Its molecular interactions can be significant in pharmacological contexts, potentially affecting receptor binding and activity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. While specific applications may vary, compounds of this nature are often explored for their therapeutic potential in treating neurological or psychiatric disorders, owing to the structural similarities with other bioactive molecules.

Formula: C₁₀H₂₁N₃O

InChI: InChI=1S/C10H21N3O/c1-3-9(2)12-10(14)8-13-6-4-11-5-7-13/h9,11H,3-8H2,1-2H3,(H,12,14)

InChI key: InChIKey=LBYYAPDSZMMRDD-UHFFFAOYSA-N

SMILES: C(C(NC(CC)C)=O)N1CCNCC1

Synonyms:

• 1-Piperazineacetamide, N-(1-methylpropyl)-
• N-(1-Methylpropyl)-1-piperazineacetamide