CAS 89433-50-1

N-Pentyl-1-piperazineacetamide

Description:

N-Pentyl-1-piperazineacetamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a pentyl group, which is a five-carbon alkyl chain, attached to the nitrogen of the piperazine, and an acetamide functional group, contributing to its overall structure and properties. It is typically a white to off-white solid or crystalline substance, and its solubility can vary depending on the solvent, often being more soluble in polar solvents due to the presence of the amide group. N-Pentyl-1-piperazineacetamide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with various biological targets, which can be explored in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific effects and safety measures can vary based on concentration and exposure.

Formula: C₁₁H₂₃N₃O

InChI: InChI=1S/C11H23N3O/c1-2-3-4-5-13-11(15)10-14-8-6-12-7-9-14/h12H,2-10H2,1H3,(H,13,15)

InChI key: InChIKey=DGOZINGOVPFLGV-UHFFFAOYSA-N

SMILES: C(C(NCCCCC)=O)N1CCNCC1

Synonyms:

• N-Pentyl-1-piperazineacetamide
• 1-Piperazineacetamide, N-pentyl-

1-Piperazineacetamide, N-pentyl-

CAS: 89433-50-1

Formula: C₁₁H₂₃N₃O

Molecular weight: 213.3198

Ref: IN-DA004420