CymitQuimica logo

CAS 894370-26-4

:

2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]benzaldehyde

Description:
2,4-Dimethyl-5-[(4-methylpiperazin-1-yl)methyl]benzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with two methyl groups and a piperazine derivative. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic and aliphatic components. Its molecular structure suggests potential interactions with biological targets, which may be explored in drug development. Additionally, the presence of multiple functional groups may influence its reactivity and stability under different conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks depending on exposure levels.
Formula:C15H22N2O
InChI:InChI=1/C15H22N2O/c1-12-8-13(2)15(11-18)9-14(12)10-17-6-4-16(3)5-7-17/h8-9,11H,4-7,10H2,1-3H3
SMILES:Cc1cc(C)c(cc1CN1CCN(C)CC1)C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.