
CAS 89438-54-0
:1,2-Dihydro-2-propyl-3H-indazol-3-one
Description:
1,2-Dihydro-2-propyl-3H-indazol-3-one, with the CAS number 89438-54-0, is a chemical compound characterized by its indazole core structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a propyl group attached to the 2-position of the indazole ring, contributing to its unique properties. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the carbonyl group (ketone) at the 3-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indazole derivatives. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-2-7-12-10(13)8-5-3-4-6-9(8)11-12/h3-6,11H,2,7H2,1H3
InChI key:InChIKey=VEYDZCOPXFSOMF-UHFFFAOYSA-N
SMILES:O=C1C=2C(NN1CCC)=CC=CC2
Synonyms:- 2-Propyl-2,3-dihydro-1H-indazol-3-one
- 3H-Indazol-3-one, 1,2-dihydro-2-propyl-
- 2-Propyl-1H-indazol-3-one
- 1,2-Dihydro-2-propyl-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
