CymitQuimica logo

CAS 894406-63-4

:

2-(trifluoromethyl)oxazolo[4,5-b]pyridine

Description:
2-(Trifluoromethyl)oxazolo[4,5-b]pyridine is a heterocyclic compound characterized by the presence of both an oxazole and a pyridine ring, with a trifluoromethyl group attached to the oxazole moiety. This compound typically exhibits a pale to light-colored appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it a subject of interest in drug design. The presence of the oxazole and pyridine rings contributes to its aromaticity and stability, while also providing sites for potential chemical reactivity. Additionally, this compound may exhibit interesting electronic properties due to the electronegative fluorine atoms, which can affect its interaction with biological targets. Overall, 2-(trifluoromethyl)oxazolo[4,5-b]pyridine is a valuable compound in the field of organic synthesis and pharmaceutical research.
Formula:C7H3F3N2O
InChI:InChI=1/C7H3F3N2O/c8-7(9,10)6-12-5-4(13-6)2-1-3-11-5/h1-3H
SMILES:c1cc2c(nc1)nc(C(F)(F)F)o2
Synonyms:
  • 2-(Trifluoromethyl)[1,3]oxazolo[4,5-b]pyridine
  • Oxazolo[4,5-B]Pyridine, 2-(Trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.