CAS 89445-80-7
:2-chloro-8-methoxy-4-methylquinoline
Description:
2-Chloro-8-methoxy-4-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a fused benzene and pyridine ring. This compound features a chlorine atom at the second position, a methoxy group (-OCH3) at the eighth position, and a methyl group (-CH3) at the fourth position of the quinoline ring. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, quinoline derivatives exhibit biological activity, and this compound may possess potential pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure contributes to its ability to interact with various biological targets. Additionally, the compound may be synthesized through specific organic reactions, and its stability can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety precautions should be observed when handling it, given the potential toxicity associated with chlorine-containing compounds.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-7-6-10(12)13-11-8(7)4-3-5-9(11)14-2/h3-6H,1-2H3
SMILES:Cc1cc(Cl)nc2c1cccc2OC
Synonyms:- Quinoline, 2-Chloro-8-Methoxy-4-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
