CymitQuimica logo

CAS 89446-12-8

:

6-Bromo-4-chloro-8-methoxy-2-methylquinoline

Description:
6-Bromo-4-chloro-8-methoxy-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. This compound features several substituents: a bromine atom at the 6-position, a chlorine atom at the 4-position, a methoxy group (-OCH3) at the 8-position, and a methyl group (-CH3) at the 2-position. These substituents contribute to its chemical reactivity and potential biological activity. The presence of halogens (bromine and chlorine) often enhances the compound's lipophilicity and can influence its interaction with biological targets. The methoxy group can also affect the compound's solubility and stability. 6-Bromo-4-chloro-8-methoxy-2-methylquinoline may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structure allows for various synthetic modifications, which can lead to the exploration of its derivatives for potential therapeutic applications.
Formula:C11H9BrClNO
InChI:InChI=1S/C11H9BrClNO/c1-6-3-9(13)8-4-7(12)5-10(15-2)11(8)14-6/h3-5H,1-2H3
InChI key:InChIKey=KPFQLSRENOSZHH-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=C(Br)C1)C(Cl)=CC(C)=N2
Synonyms:
  • 6-Bromo-4-chloro-8-methoxy-2-methylquinoline
  • Quinoline, 6-bromo-4-chloro-8-methoxy-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.