CAS 89446-20-8
:6-Bromo-N,N,4-trimethyl-2-quinolinamine
Description:
6-Bromo-N,N,4-trimethyl-2-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a bromine atom at the 6-position of the quinoline ring introduces notable reactivity and influences its physical and chemical properties. The N,N,4-trimethyl substituents contribute to its overall steric bulk and can affect solubility and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit distinct color properties due to its conjugated system. It is often used in various chemical syntheses and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's reactivity can be attributed to the electron-withdrawing nature of the bromine atom, which can enhance electrophilic substitution reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Bromo-N,N,4-trimethyl-2-quinolinamine is a versatile compound with potential applications in research and industry.
Formula:C12H13BrN2
InChI:InChI=1S/C12H13BrN2/c1-8-6-12(15(2)3)14-11-5-4-9(13)7-10(8)11/h4-7H,1-3H3
InChI key:InChIKey=OFCQCVPVKUPTDE-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(N(C)C)C1)C=CC(Br)=C2
Synonyms:- 6-Bromo-N,N,4-trimethyl-2-quinolinamine
- 2-Quinolinamine, 6-bromo-N,N,4-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
